What is the IUPAC name of erucamide?
The IUPAC name of erucamide is (Z)-docos-13-enamide.
What is the molecular formula of erucamide?
The molecular formula of erucamide is C22H43NO.
What is the boiling point of erucamide?
The boiling point of erucamide is approximately 473.86 °C.
What is the melting point of erucamide?
The melting point of erucamide is 79-81 °C.
What is the appearance of erucamide?
Erucamide appears as an off-white solid.
What is the purity of erucamide?
The purity of erucamide is 97%.
What is the storage recommendation for erucamide?
It is recommended to store erucamide in the freezer.
What are some typical applications of erucamide?
Erucamide can be used as a dispersing agent, emulsifying agent, and lubricant.
What is the CAS number of erucamide?
The CAS number of erucamide is 112-84-5.
What is the InChI Key of erucamide?
The InChI Key of erucamide is InChI=1S/C22H43NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h9-10H,2-8,11-21H2,1H3,(H2,23,24)/b10-9-.
PAGE TOP