What is the molecular formula of Docusate Sodium?
The molecular formula of Docusate Sodium is C20H37NaO7S.
What are some synonyms for Docusate Sodium?
Some synonyms for Docusate Sodium are Dioctyl sodium sulfosuccinate, Aerosol OT, and Dioctyl sulfosuccinate sodium salt.
What is the molecular weight of Docusate Sodium?
The molecular weight of Docusate Sodium is 444.6 g/mol.
What is the IUPAC name of Docusate Sodium?
The IUPAC name of Docusate Sodium is sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate.
What is the InChI code for Docusate Sodium?
The InChI code for Docusate Sodium is InChI=1S/C20H38O7S.Na/c1-5-9-11-16(7-3)14-26-19(21)13-18(28(23,24)25)20(22)27-15-17(8-4)12-10-6-2;/h16-18H,5-15H2,1-4H3,(H,23,24,25);/q;+1/p-1
What is the InChIKey for Docusate Sodium?
The InChIKey for Docusate Sodium is APSBXTVYXVQYAB-UHFFFAOYSA-M.
What is the Canonical SMILES of Docusate Sodium?
The Canonical SMILES of Docusate Sodium is CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)S(=O)(=O)[O-].[Na+].
What is the hydrogen bond donor count of Docusate Sodium?
The hydrogen bond donor count of Docusate Sodium is 0.
What is the hydrogen bond acceptor count of Docusate Sodium?
The hydrogen bond acceptor count of Docusate Sodium is 7.
How many rotatable bonds does Docusate Sodium have?
Docusate Sodium has 18 rotatable bonds.
PAGE TOP