What is the CAS number of Distearyl thiodipropionate?
The CAS number of Distearyl thiodipropionate is 693-36-7.
What is the molecular weight of Distearyl thiodipropionate?
The molecular weight of Distearyl thiodipropionate is 683.16.
What is the molecular formula of Distearyl thiodipropionate?
The molecular formula of Distearyl thiodipropionate is C42H82O4S.
What is the InChI of Distearyl thiodipropionate?
The InChI of Distearyl thiodipropionate is InChI=1S/C42H82O4S/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37-45-41(43)35-39-47-40-36-42(44)46-38-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h3-40H2,1-2H3.
What is the boiling point of Distearyl thiodipropionate?
The boiling point of Distearyl thiodipropionate is 665 °C.
What is the melting point of Distearyl thiodipropionate?
The melting point of Distearyl thiodipropionate is 65-67 °C.
What is the flash point of Distearyl thiodipropionate?
The flash point of Distearyl thiodipropionate is 237 °C.
What is the density of Distearyl thiodipropionate?
The density of Distearyl thiodipropionate is 0.899g/ml.
What is the typical application of Distearyl thiodipropionate?
The typical applications of Distearyl thiodipropionate include use as antioxidant, use as lubricant, and use as dispersing agent/emulsion stabilizer.
What percentage of actives does Distearyl thiodipropionate contain?
Distearyl thiodipropionate contains 95% actives.
PAGE TOP