What is the product name of diisostearyl maleate?
The product name of diisostearyl maleate is diisostearyl maleate.
What is the CAS number of diisostearyl maleate?
The CAS number of diisostearyl maleate is 112385-09-8.
What is the molecular weight of diisostearyl maleate?
The molecular weight of diisostearyl maleate is 621.03.
What is the molecular formula of diisostearyl maleate?
The molecular formula of diisostearyl maleate is C40H76O4.
What are some synonyms for diisostearyl maleate?
Some synonyms for diisostearyl maleate include 2-Butenedioic acid (2Z)-, 1,4-diisooctadecyl ester and Bis(16-methylheptadecyl) (Z)-but-2-enedioate.
What is the SMILES representation of diisostearyl maleate?
The SMILES representation of diisostearyl maleate is CC(C)CCCCCCCCCCCCCCCOC(=O)/C=C\C(=O)OCCCCCCCCCCCCCCCC(C)C.
What is the percentage of actives in diisostearyl maleate?
The percentage of actives in diisostearyl maleate is 95%.
What is the physical state of diisostearyl maleate?
The physical state of diisostearyl maleate is liquid.
What are some typical applications of diisostearyl maleate?
A typical application of diisostearyl maleate is as an emollient.
What is the InChI Key of diisostearyl maleate?
The InChI Key of diisostearyl maleate is InChI=1S/C40H76O4/c1-37(2)31-27-23-19-15-11-7-5-9-13-17-21-25-29-35-43-39(41)33-34-40(42)44-36-30-26-22-18-14-10-6-8-12-16-20-24-28-32-38(3)4/h33-34,37-38H,5-32,35-36H2,1-4H3/b34-33-
PAGE TOP