What is the CAS number of Dihexyldecyl lauroyl glutamate?
The CAS number of Dihexyldecyl lauroyl glutamate is 172944-28-4.
What are some synonyms of Dihexyldecyl lauroyl glutamate?
Some synonyms of Dihexyldecyl lauroyl glutamate are L-Glutamic acid, N-(1-oxododecyl)-, bis(2-hexyldecyl) ester.
What is the IUPAC name of Dihexyldecyl lauroyl glutamate?
The IUPAC name of Dihexyldecyl lauroyl glutamate is Bis(2-hexyldecyl) (2S)-2-(dodecanoylamino)pentanedioate.
What is the molecular weight of Dihexyldecyl lauroyl glutamate?
The molecular weight of Dihexyldecyl lauroyl glutamate is 778.28.
What is the molecular formula of Dihexyldecyl lauroyl glutamate?
The molecular formula of Dihexyldecyl lauroyl glutamate is C49H95NO5.
What is the SMILES representation of Dihexyldecyl lauroyl glutamate?
The SMILES representation of Dihexyldecyl lauroyl glutamate is CCCCCCCCCCCC(=O)N[C@@H](CCC(=O)OCC(CCCCCC)CCCCCCCC)C(=O)OCC(CCCCCC)CCCCCCCC.
What is the InChI key of Dihexyldecyl lauroyl glutamate?
The InChI key of Dihexyldecyl lauroyl glutamate is InChI=1S/C49H95NO5/c1-6-11-16-21-24-25-26-29-34-39-47(51)50-46(49(53)55-43-45(36-31-20-15-10-5)38-33-28-23-18-13-8-3)40-41-48(52)54-42-44(35-30-19-14-9-4)37-32-27-22-17-12-7-2/h44-46H,6-43H2,1-5H3,(H,50,51)/t44?,45?,46-/m0/s1.
What is the percentage of actives in Dihexyldecyl lauroyl glutamate?
The percentage of actives in Dihexyldecyl lauroyl glutamate is 95%.
In what physical state is Dihexyldecyl lauroyl glutamate?
Dihexyldecyl lauroyl glutamate is in a liquid physical state.
What are some typical applications of Dihexyldecyl lauroyl glutamate?
Some typical applications of Dihexyldecyl lauroyl glutamate are as an emollient and for skin conditioning.