What is the molecular formula of diethylene glycol dibenzoate?
The molecular formula of diethylene glycol dibenzoate is (C6H5COOCH2CH2)2O or C18H18O5.
What is the molecular weight of diethylene glycol dibenzoate?
The molecular weight of diethylene glycol dibenzoate is 314.3 g/mol.
What is the IUPAC name of diethylene glycol dibenzoate?
The IUPAC name of diethylene glycol dibenzoate is 2-(2-benzoyloxyethoxy)ethyl benzoate.
What is the InChI of diethylene glycol dibenzoate?
The InChI of diethylene glycol dibenzoate is InChI=1S/C18H18O5/c19-17(15-7-3-1-4-8-15)22-13-11-21-12-14-23-18(20)16-9-5-2-6-10-16/h1-10H,11-14H2.
What is the InChIKey of diethylene glycol dibenzoate?
The InChIKey of diethylene glycol dibenzoate is NXQMCAOPTPLPRL-UHFFFAOYSA-N.
What are some synonyms of diethylene glycol dibenzoate?
Some synonyms of diethylene glycol dibenzoate include Oxybis(ethane-2,1-diyl) dibenzoate, Benzo Flex 2-45, and Oxydiethylene dibenzoate.
What are some identifiers associated with diethylene glycol dibenzoate?
Some identifiers associated with diethylene glycol dibenzoate include CAS number 120-55-8, European Community (EC) Number 204-407-6, and UNII YAI66YDY1C.
What is the XLogP3 value of diethylene glycol dibenzoate?
The XLogP3 value of diethylene glycol dibenzoate is 3.4.
How many hydrogen bond acceptor counts does diethylene glycol dibenzoate have?
Diethylene glycol dibenzoate has 5 hydrogen bond acceptor counts.
What is the topological polar surface area of diethylene glycol dibenzoate?
The topological polar surface area of diethylene glycol dibenzoate is 61.8Ų.
PAGE TOP