What is the chemical name of the product with the CAS number 861390-34-3?
The chemical name of the product is Dibutyl ethylhexanoyl glutamide.
What are the synonyms for Dibutyl ethylhexanoyl glutamide?
The synonyms for Dibutyl ethylhexanoyl glutamide are Pentanediamide N,N'-dibutyl-2-((2-ethyl-1-oxohexyl)amino)-.
What is the molecular weight of Dibutyl ethylhexanoyl glutamide?
The molecular weight of Dibutyl ethylhexanoyl glutamide is 383.57.
What is the molecular formula of Dibutyl ethylhexanoyl glutamide?
The molecular formula of Dibutyl ethylhexanoyl glutamide is C21H41N3O3.
What is the SMILES notation for Dibutyl ethylhexanoyl glutamide?
The SMILES notation for Dibutyl ethylhexanoyl glutamide is CCCCC(CC)C(=O)NC(CCCNCCCC)CNCCCC.
What is the InChI key for Dibutyl ethylhexanoyl glutamide?
The InChI key for Dibutyl ethylhexanoyl glutamide is InChI=1S/C21H45N3O/c1-5-9-13-19(8-4)21(25)24-20(18-23-16-11-7-3)14-12-17-22-15-10-6-2/h19-20,22-23H,5-18H2,1-4H3,(H,24,25).
What is the boiling point of Dibutyl ethylhexanoyl glutamide?
The boiling point of Dibutyl ethylhexanoyl glutamide is 642.0±50.0 °C.
What is the density of Dibutyl ethylhexanoyl glutamide?
The density of Dibutyl ethylhexanoyl glutamide is 0.974±0.06g/ml.
What is the percentage of actives in Dibutyl ethylhexanoyl glutamide?
The percentage of actives in Dibutyl ethylhexanoyl glutamide is 95%.
What are the typical applications of Dibutyl ethylhexanoyl glutamide?
The typical applications of Dibutyl ethylhexanoyl glutamide are skin and hair conditioning, and viscosity increasing agent.
PAGE TOP