What is the molecular formula of Decyl glucoside?
The molecular formula of Decyl glucoside is C16H32O6.
When was the PubChem CID for Decyl glucoside created?
The PubChem CID for Decyl glucoside was created on August 8, 2005.
What is the molecular weight of Decyl glucoside?
The molecular weight of Decyl glucoside is 320.42 g/mol.
What is the IUPAC name of Decyl glucoside?
The IUPAC name of Decyl glucoside is (3R, 4S, 5S, 6R)-2-decoxy-6-(hydroxymethyl)oxane-3,4,5-triol.
What is the Canonical SMILES for Decyl glucoside?
The Canonical SMILES for Decyl glucoside is CCCCCCCCCCOC1C(C(C(C(O1)CO)O)O)O.
What is the CAS number for Decyl glucoside?
The CAS number for Decyl glucoside is 54549-25-6.
What is the XLogP3-AA value for Decyl glucoside?
The XLogP3-AA value for Decyl glucoside is 2.4.
How many hydrogen bond donor counts are present in Decyl glucoside?
There are 4 hydrogen bond donor counts present in Decyl glucoside.
How many rotatable bond counts are present in Decyl glucoside?
There are 11 rotatable bond counts present in Decyl glucoside.
What is the topological polar surface area of Decyl glucoside?
The topological polar surface area of Decyl glucoside is 99.42.
What are the synonyms for Decyl glucoside?
The synonyms for Decyl glucoside include Decyl D-glucopyranoside and Decyl D-glucoside.
When was Decyl glucoside first created according to PubChem?
Decyl glucoside was first created on August 8, 2005.
What is the InChIKey of Decyl glucoside?
The InChIKey of Decyl glucoside is JDRSMPFHFNXQRB-IWQYDBTJSA-N.
What is the XLogP3-AA value of Decyl glucoside?
The XLogP3-AA value of Decyl glucoside is 2.4.
How many hydrogen bond donor counts does Decyl glucoside have?
Decyl glucoside has 4 hydrogen bond donor counts.
PAGE TOP