What is the IUPAC name for D-Ribose?
The IUPAC name for D-Ribose is (2R,3R,4R)-2,3,4,5-tetrahydroxypentanal.
What is the CAS number for D-Ribose?
The CAS number for D-Ribose is 50-69-1.
What is the molecular weight of D-Ribose?
The molecular weight of D-Ribose is 150.13.
What is the molecular formula of D-Ribose?
The molecular formula of D-Ribose is C5H10O5.
What is the boiling point of D-Ribose?
The boiling point of D-Ribose is 191.5°C.
What is the melting point of D-Ribose?
The melting point of D-Ribose is 88-92 °C.
What is the density of D-Ribose?
The density of D-Ribose is 1.19g/ml.
What is the percentage of actives in D-Ribose?
The percentage of actives in D-Ribose is 95%.
What is the typical application of D-Ribose?
The typical application of D-Ribose is in perfume.
What is the InChI Key for D-Ribose?
The InChI Key for D-Ribose is InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2/t3-,4+,5-/m0/s1.
PAGE TOP