
What is the molecular formula of Coenzyme A?
The molecular formula of Coenzyme A is C21H36N7O16P3S.
What is the molecular weight of Coenzyme A?
The molecular weight of Coenzyme A is 767.5 g/mol.
What is the IUPAC name of Coenzyme A?
The IUPAC name of Coenzyme A is [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-[[3-oxo-3-(2-sulfanylethylamino)propyl]amino]butyl] hydrogen phosphate.
What is the InChI of Coenzyme A?
The InChI of Coenzyme A is InChI=1S/C21H36N7O16P3S/c1-21(2,16(31)19(32)24-4-3-12(29)23-5-6-48)8-41-47(38,39)44-46(36,37)40-7-11-15(43-45(33,34)35)14(30)20(42-11)28-10-27-13-17(22)25-9-26-18(13)28/h9-11,14-16,20,30-31,48H,3-8H2,1-2H3,(H,23,29)(H,24,32)(H,36,37)(H,38,39)(H2,22,25,26)(H2,33,34,35)/t11-,14-,15-,16+,20-/m1/s1.
What is the Canonical SMILES of Coenzyme A?
The Canonical SMILES of Coenzyme A is CC(C)(COP(=O)(O)OP(=O)(O)OCC1C(C(C(O1)N2C=NC3=C(N=CN=C32)N)O)OP(=O)(O)O)C(C(=O)NCCC(=O)NCCS)O.
What is the CAS number of Coenzyme A?
The CAS number of Coenzyme A is 85-61-0.
What is the EC number of Coenzyme A?
The EC number of Coenzyme A is 201-619-0.
What is the ChEMBL ID of Coenzyme A?
The ChEMBL ID of Coenzyme A is CHEMBL1213327.
What is the KEGG ID of Coenzyme A?
The KEGG ID of Coenzyme A is C00010.
What is the Wikipedia page of Coenzyme A?
The Wikipedia page of Coenzyme A is "Coenzyme A".