What is the PubChem CID of clobetasol?
The PubChem CID of clobetasol is 5311051.
What is the molecular formula of clobetasol?
The molecular formula of clobetasol is C22H28ClFO4.
What is the molecular weight of clobetasol?
The molecular weight of clobetasol is 410.9 g/mol.
What is the IUPAC name of clobetasol?
The IUPAC name of clobetasol is (8S,9R,10S,11S,13S,14S,16S,17R)-17-(2-chloroacetyl)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one.
What is the InChI of clobetasol?
The InChI of clobetasol is InChI=1S/C22H28ClFO4/c1-12-8-16-15-5-4-13-9-14(25)6-7-19(13,2)21(15,24)17(26)10-20(16,3)22(12,28)18(27)11-23/h6-7,9,12,15-17,26,28H,4-5,8,10-11H2,1-3H3/t12-,15-,16-,17-,19-,20-,21-,22-/m0/s1.
What is the InChIKey of clobetasol?
The InChIKey of clobetasol is FCSHDIVRCWTZOX-DVTGEIKXSA-N.
What is the canonical SMILES of clobetasol?
The canonical SMILES of clobetasol is CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)CCl)O)C)O)F)C.
What is the CAS number of clobetasol?
The CAS number of clobetasol is 25122-41-2.
What is the ChEMBL ID of clobetasol?
The ChEMBL ID of clobetasol is CHEMBL1201362.
What is the Nikkaji Number of clobetasol?
The Nikkaji Number of clobetasol is J19.393C.