What is the molecular formula of Chlorophyll a?
The molecular formula of Chlorophyll a is C55H72MgN4O5.
What is the molecular weight of Chlorophyll a?
The molecular weight of Chlorophyll a is 893.5 g/mol.
What is the structure of Chlorophyll a?
The structure of Chlorophyll a is a porphyrin derivative conjugated with a magnesium ion.
What is the role of Chlorophyll a in photosynthesis?
Chlorophyll a is essential to the process of photosynthesis. It absorbs light in the blue and red parts of the visible spectrum and transfers the absorbed photon energy to an electron, which is used to produce ATP.
What is the IUPAC name of Chlorophyll a?
The IUPAC name of Chlorophyll a is magnesium;methyl (3R,21S,22S)-16-ethenyl-11-ethyl-12,17,21,26-tetramethyl-4-oxo-22-[3-oxo-3-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enoxy]propyl]-23,25-diaza-7,24-diazanidahexacyclo[18.2.1.15,8.110,13.115,18.02,6]hexacosa-1,5,8(26),9,11,13(25),14,16,18,20(23)-decaene-3-carboxylate.
What is the canonical SMILES of Chlorophyll a?
The canonical SMILES of Chlorophyll a is CCC1=C(C2=NC1=CC3=C(C4=C([N-]3)C(=C5C(C(C(=N5)C=C6C(=C(C(=C2)[N-]6)C=C)C)C)CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C(C4=O)C(=O)OC)C)C.[Mg+2].
What is the InChIKey of Chlorophyll a?
The InChIKey of Chlorophyll a is ATNHDLDRLWWWCB-AENOIHSZSA-M.
What is the CAS number of Chlorophyll a?
The CAS number of Chlorophyll a is 479-61-8.
What are the synonyms of Chlorophyll a?
The synonyms of Chlorophyll a include CHLOROPHYLLA, CHLOROPHYLL.
What are the related compounds to Chlorophyll a?
The related compounds to Chlorophyll a include magnesium, and Pheophytin a.