What is the molecular formula of chitin?
The molecular formula of chitin is C8H15NO6.
What is the molecular weight of chitin?
The molecular weight of chitin is 221.21 g/mol.
What is another name for chitin?
Another name for chitin is N-Acetyl-beta-D-glucosamine.
What is the role of chitin?
Chitin has a role as a vulnerary, a human metabolite, a Saccharomyces cerevisiae metabolite, and a mouse metabolite.
What is the structure of chitin?
Chitin is an aminoglycan consisting of beta-(1->4)-linked N-acetyl-D-glucosamine residues.
What is the InChIKey of chitin?
The InChIKey of chitin is OVRNDRQMDRJTHS-FMDGEEDCSA-N.
What is the Canonical SMILES of chitin?
The Canonical SMILES of chitin is CC(=O)NC1C(C(C(OC1O)CO)O)O.
What is the XLogP3 value of chitin?
The XLogP3 value of chitin is -1.7.
How many hydrogen bond donor counts are there in chitin?
There are 5 hydrogen bond donor counts in chitin.
What is the topological polar surface area of chitin?
The topological polar surface area of chitin is 119Ų.