What is the CAS number of Cetyl myristate?
The CAS number of Cetyl myristate is 2599-01-1.
What are some synonyms for Cetyl myristate?
Some synonyms for Cetyl myristate include Hexadecyl myristate and Tetradecanoic acid, hexadecyl ester.
What is the IUPAC name of Cetyl myristate?
The IUPAC name of Cetyl myristate is Hexadecyl tetradecanoate.
What is the molecular weight of Cetyl myristate?
The molecular weight of Cetyl myristate is 452.8.
What is the molecular formula of Cetyl myristate?
The molecular formula of Cetyl myristate is C30H60O2.
What is the SMILES notation for Cetyl myristate?
The SMILES notation for Cetyl myristate is CCCCCCCCCCCCCCCCOC(=O)CCCCCCCCCCCCC.
What is the InChI Key for Cetyl myristate?
The InChI Key for Cetyl myristate is InChI=1S/C30H60O2/c1-3-5-7-9-11-13-15-16-17-19-21-23-25-27-29-32-30(31)28-26-24-22-20-18-14-12-10-8-6-4-2/h3-29H2,1-2H3.
What is the melting point of Cetyl myristate?
The melting point of Cetyl myristate is 51-52 °C.
What is the percentage of actives in Cetyl myristate?
The percentage of actives in Cetyl myristate is 95%.
What are some typical applications of Cetyl myristate?
Some typical applications of Cetyl myristate include use as a lubricant, dispersing agent, and emulsion stabilizer.