
What is the PubChem CID for Benzyltributylammonium Bromide?
The PubChem CID for Benzyltributylammonium Bromide is 2724282.
What is the molecular formula of Benzyltributylammonium Bromide?
The molecular formula of Benzyltributylammonium Bromide is C19H34BrN.
What is the molecular weight of Benzyltributylammonium Bromide?
The molecular weight of Benzyltributylammonium Bromide is 356.4 g/mol.
What is the IUPAC name of Benzyltributylammonium Bromide?
The IUPAC name of Benzyltributylammonium Bromide is benzyl(tributyl)azanium;bromide.
What is the InChI of Benzyltributylammonium Bromide?
The InChI of Benzyltributylammonium Bromide is InChI=1S/C19H34N.BrH/c1-4-7-15-20(16-8-5-2,17-9-6-3)18-19-13-11-10-12-14-19;/h10-14H,4-9,15-18H2,1-3H3;1H/q+1;/p-1.
What is the canonical SMILES of Benzyltributylammonium Bromide?
The canonical SMILES of Benzyltributylammonium Bromide is CCCC[N+](CCCC)(CCCC)CC1=CC=CC=C1.[Br-].
What is the CAS number of Benzyltributylammonium Bromide?
The CAS number of Benzyltributylammonium Bromide is 25316-59-0.
What is the European Community (EC) Number of Benzyltributylammonium Bromide?
The European Community (EC) Number of Benzyltributylammonium Bromide is 246-819-9.
What is the molecular weight of Benzyltributylammonium Bromide according to PubChem?
The molecular weight of Benzyltributylammonium Bromide is 356.4 g/mol according to PubChem.
Is Benzyltributylammonium Bromide a covalently-bonded compound?
Yes, Benzyltributylammonium Bromide is a covalently-bonded compound with a covalently-bonded unit count of 2 according to PubChem.