
What is the CAS number of Alpha-Bromocinnamaldehyde?
The CAS number of Alpha-Bromocinnamaldehyde is 5443-49-2.
What are some synonyms for Alpha-Bromocinnamaldehyde?
Some synonyms for Alpha-Bromocinnamaldehyde are 2-Propenal, 2-bromo-3-phenyl-, and Bromocinnamal.
What is the molecular weight of Alpha-Bromocinnamaldehyde?
The molecular weight of Alpha-Bromocinnamaldehyde is 211.06.
What is the molecular formula of Alpha-Bromocinnamaldehyde?
The molecular formula of Alpha-Bromocinnamaldehyde is C9H7BrO.
What is the SMILES notation for Alpha-Bromocinnamaldehyde?
The SMILES notation for Alpha-Bromocinnamaldehyde is C1=CC=C(C=C1)/C=C(/C=O)\Br.
What is the InChI Key for Alpha-Bromocinnamaldehyde?
The InChI Key for Alpha-Bromocinnamaldehyde is InChI=1S/C9H7BrO/c10-9(7-11)6-8-4-2-1-3-5-8/h1-7H/b9-6-.
What is the boiling point of Alpha-Bromocinnamaldehyde?
The boiling point of Alpha-Bromocinnamaldehyde is 304.5±30.0 °C.
What is the melting point of Alpha-Bromocinnamaldehyde?
The melting point of Alpha-Bromocinnamaldehyde is 66-68 °C (lit.).
What is the purity of Alpha-Bromocinnamaldehyde?
The purity of Alpha-Bromocinnamaldehyde is >98.0%.
What are the typical applications of Alpha-Bromocinnamaldehyde?
The typical applications of Alpha-Bromocinnamaldehyde are as an antimicrobial agent and preservative.