What is the molecular formula of alpha-Arbutin?
The molecular formula of alpha-Arbutin is C12H16O7.
When was alpha-Arbutin first created?
Alpha-Arbutin was first created on June 24, 2005.
What is another name for alpha-Arbutin?
Another name for alpha-Arbutin is 4-Hydroxyphenyl a-D-glucopyranoside.
What is the molecular weight of alpha-Arbutin?
The molecular weight of alpha-Arbutin is 272.25 g/mol.
What is the IUPAC Name of alpha-Arbutin?
The IUPAC Name of alpha-Arbutin is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(4-hydroxyphenoxy)oxane-3,4,5-triol.
What is the Canonical SMILES of alpha-Arbutin?
The Canonical SMILES of alpha-Arbutin is C1=CC(=CC=C1O)OC2C(C(C(C(O2)CO)O)O)O.
What is the InChIKey of alpha-Arbutin?
The InChIKey of alpha-Arbutin is BJRNKVDFDLYUGJ-ZIQFBCGOSA-N.
How many hydrogen bond donor counts does alpha-Arbutin have?
Alpha-Arbutin has 5 hydrogen bond donor counts.
What is the XLogP3 value of alpha-Arbutin?
The XLogP3 value of alpha-Arbutin is -0.7.
Where can alpha-Arbutin be found naturally?
Alpha-Arbutin can be found naturally in Rhodiola chrysanthemifolia and Rhodiola sacra.