What is the CAS number of Adipic acid, bis(2-ethylhexyl) ester?
The CAS number of Adipic acid, bis(2-ethylhexyl) ester is 103-23-1.
What are some synonyms for Adipic acid, bis(2-ethylhexyl) ester?
Some synonyms for Adipic acid, bis(2-ethylhexyl) ester are Bis(2-ethylhexyl) adipate, Di-2-ethylhexyl adipate, and DEHA.
What is the molecular weight of Adipic acid, bis(2-ethylhexyl) ester?
The molecular weight of Adipic acid, bis(2-ethylhexyl) ester is 370.57.
What is the molecular formula of Adipic acid, bis(2-ethylhexyl) ester?
The molecular formula of Adipic acid, bis(2-ethylhexyl) ester is C22H42O4.
What is the InChI key for Adipic acid, bis(2-ethylhexyl) ester?
The InChI key for Adipic acid, bis(2-ethylhexyl) ester is InChI=1S/C22H42O4/c1-5-9-13-19(7-3)17-25-21(23)15-11-12-16-22(24)26-18-20(8-4)14-10-6-2/h19-20H,5-18H2,1-4H3.
What is the boiling point of Adipic acid, bis(2-ethylhexyl) ester?
The boiling point of Adipic acid, bis(2-ethylhexyl) ester is 417 °C.
What is the melting point of Adipic acid, bis(2-ethylhexyl) ester?
The melting point of Adipic acid, bis(2-ethylhexyl) ester is -67 °C.
What is the density of Adipic acid, bis(2-ethylhexyl) ester?
The density of Adipic acid, bis(2-ethylhexyl) ester is 0.925g/ml.
What are some typical applications of Adipic acid, bis(2-ethylhexyl) ester?
Some typical applications of Adipic acid, bis(2-ethylhexyl) ester are use as a lubricant, dispersing agent, emulsion stabilizer, and plasticizer.
What is the physical state of Adipic acid, bis(2-ethylhexyl) ester?
The physical state of Adipic acid, bis(2-ethylhexyl) ester is a liquid.
PAGE TOP