What is the molecular formula of Acid yellow 49?
The molecular formula of Acid yellow 49 is C16H13Cl2N5O3S.
What is the molecular weight of Acid yellow 49?
The molecular weight of Acid yellow 49 is 426.3 g/mol.
What is the IUPAC name of Acid yellow 49?
The IUPAC name of Acid yellow 49 is 4-[(5-amino-3-methyl-1-phenylpyrazol-4-yl)diazenyl]-2,5-dichlorobenzenesulfonic acid.
What is the InChI of Acid yellow 49?
The InChI of Acid yellow 49 is InChI=1S/C16H13Cl2N5O3S/c1-9-15(16(19)23(22-9)10-5-3-2-4-6-10)21-20-13-7-12(18)14(8-11(13)17)27(24,25)26/h2-8H,19H2,1H3,(H,24,25,26).
What is the InChIKey of Acid yellow 49?
The InChIKey of Acid yellow 49 is QHVBDWZOQBMLLW-UHFFFAOYSA-N.
What is the canonical SMILES of Acid yellow 49?
The canonical SMILES of Acid yellow 49 is CC1=NN(C(=C1N=NC2=CC(=C(C=C2Cl)S(=O)(=O)O)Cl)N)C3=CC=CC=C3.
What is the CAS number of Acid yellow 49?
The CAS number of Acid yellow 49 is 12239-15-5.
What is the XLogP3-AA value of Acid yellow 49?
The XLogP3-AA value of Acid yellow 49 is 3.7.
How many hydrogen bond donor counts does Acid yellow 49 have?
Acid yellow 49 has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Acid yellow 49 have?
Acid yellow 49 has 7 hydrogen bond acceptor counts.
PAGE TOP