
What is the PubChem CID for Acid Orange 10?
PubChem CID 16015
What is the molecular formula of Acid Orange 10?
C16H10N2Na2O7S2
When was Acid Orange 10 first created?
Acid Orange 10 was first created in 2005-07-19.
What is another name for Acid Orange 10?
Orange G, C.I. Orange G, C.I. Acid Orange 10
What is the molecular weight of Acid Orange 10?
452.4 g/mol
What is the IUPAC name of Acid Orange 10?
disodium;7-hydroxy-8-phenyldiazenylnaphthalene-1,3-disulfonate
What is the InChIKey of Acid Orange 10?
HSXUHWZMNJHFRV-UHFFFAOYSA-L
What is the Canonical SMILES of Acid Orange 10?
C1=CC=C(C=C1)N=NC2=C(C=CC3=CC(=CC(=C32)S(=O)(=O)[O-])S(=O)(=O)[O-])O.[Na+].[Na+]
What is the UNII number of Acid Orange 10?
1Q6EJU80RN
What is the topological polar surface area of Acid Orange 10?
176 Å2