What is the molecular formula of ACID BLUE 1 according to the reference?
The molecular formula of ACID BLUE 1 is C27H31N2NaO6S2.
What is the molecular weight of ACID BLUE 1?
The molecular weight of ACID BLUE 1 is 566.7 g/mol.
What are some synonyms for ACID BLUE 1?
Some synonyms for ACID BLUE 1 are Sulfan Blue, Acid blue 1, Patent Blue VF, and Patent Blue.
What is the IUPAC Name of ACID BLUE 1?
The IUPAC Name of ACID BLUE 1 is sodium;4-[[4-(diethylamino)phenyl]-(4-diethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)methyl]benzene-1,3-disulfonate.
What is the InChIKey of ACID BLUE 1?
The InChIKey of ACID BLUE 1 is SJEYSFABYSGQBG-UHFFFAOYSA-M.
What is the Canonical SMILES of ACID BLUE 1?
The Canonical SMILES of ACID BLUE 1 is CCN(CC)C1=CC=C(C=C1)C(=C2C=CC(=[N+](CC)CC)C=C2)C3=C(C=C(C=C3)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].
What is the CAS number of ACID BLUE 1?
The CAS number of ACID BLUE 1 is 129-17-9.
How many hydrogen bond acceptors does ACID BLUE 1 have?
ACID BLUE 1 has 7 hydrogen bond acceptors.
What is the exact mass of ACID BLUE 1?
The exact mass of ACID BLUE 1 is 566.15212334 g/mol.
What is the topological polar surface area of ACID BLUE 1?
The topological polar surface area of ACID BLUE 1 is 137 Ų.