What is the CAS number for 4-Pentylphenyl 4-Methoxybenzoate?
The CAS number is 38444-13-2.
What are some synonyms for 4-Pentylphenyl 4-Methoxybenzoate?
Some synonyms are 4-Methoxybenzoic Acid 4-Pentylphenyl Ester, 4-Amylphenyl 4-Methoxybenzoate, and 4-Methoxybenzoic Acid 4-Amylphenyl Ester.
What is the molecular weight of 4-Pentylphenyl 4-Methoxybenzoate?
The molecular weight is 298.38.
What is the molecular formula of 4-Pentylphenyl 4-Methoxybenzoate?
The molecular formula is C19H22O3.
What is the SMILES notation for 4-Pentylphenyl 4-Methoxybenzoate?
The SMILES notation is CCCCCc1ccc(OC(=O)c2ccc(OC)cc2)cc1.
What is the InChI Key for 4-Pentylphenyl 4-Methoxybenzoate?
The InChI Key is UISXVYOLBGBYCV-UHFFFAOYSA-N.
What is the melting point of 4-Pentylphenyl 4-Methoxybenzoate?
The melting point is 29 °C.
What is the purity of 4-Pentylphenyl 4-Methoxybenzoate?
The purity is >98.0% (GC).
How should 4-Pentylphenyl 4-Methoxybenzoate be stored?
It should be kept cold.
What are some typical applications of 4-Pentylphenyl 4-Methoxybenzoate?
Some typical applications are as a dispersing agent, emulsion stabilizer, and as a lubricant.