What is the IUPAC name of 3-Octanol, acetate?
The IUPAC name of 3-Octanol, acetate is octan-3-yl acetate.
What is the molecular weight of 3-Octanol, acetate?
The molecular weight of 3-Octanol, acetate is 172.26.
What is the molecular formula of 3-Octanol, acetate?
The molecular formula of 3-Octanol, acetate is C10H20O2.
What is the SMILES representation of 3-Octanol, acetate?
The SMILES representation of 3-Octanol, acetate is CCCCCC(CC)OC(=O)C.
What is the InChI of 3-Octanol, acetate?
The InChI of 3-Octanol, acetate is InChI=1S/C10H20O2/c1-4-6-7-8-10(5-2)12-9(3)11/h10H,4-8H2,1-3H3.
What is the boiling point of 3-Octanol, acetate?
The boiling point of 3-Octanol, acetate is 99 °C at 18mmHg (lit.).
What is the melting point of 3-Octanol, acetate?
The melting point of 3-Octanol, acetate is -65.5°C.
What is the density of 3-Octanol, acetate?
The density of 3-Octanol, acetate is 0.86g/ml.
What is the percentage of actives in 3-Octanol, acetate?
The percentage of actives in 3-Octanol, acetate is 95%.
What are some typical applications of 3-Octanol, acetate?
Some typical applications of 3-Octanol, acetate include its use in perfume.