What is the product name of this compound?
The product name of this compound is 2-Octyldodecyl isooctadecanoate.
What is the CAS number of this compound?
The CAS number of this compound is 93803-87-3.
What are some synonyms for this compound?
Some synonyms for this compound are Octyldodecyl Isostearate and 2-Octyldodecyl 16-methylheptadecanoate.
What is the molecular weight of this compound?
The molecular weight of this compound is 565.01.
What is the molecular formula of this compound?
The molecular formula of this compound is C38H76O2.
What is the SMILES representation of this compound?
The SMILES representation of this compound is CCCCCCCCCCC(CCCCCCCC)COC(=O)CCCCCCCCCCCCCCC(C)C.
What is the InChI Key of this compound?
The InChI Key of this compound is InChI=1S/C38H76O2/c1-5-7-9-11-13-21-25-29-33-37(32-28-24-12-10-8-6-2)35-40-38(39)34-30-26-22-19-17-15-14-16-18-20-23-27-31-36(3)4/h36-37H,5-35H2,1-4H3.
What is the purity of this compound?
The purity of this compound is 96%.
What are the typical applications of this compound?
The typical applications of this compound include skin conditioning.
What percentage of actives does this compound contain?
This compound contains 95% actives.
PAGE TOP