What is the molecular formula of 2-Acrylamido-2-methylpropanesulfonic acid?
The molecular formula of 2-Acrylamido-2-methylpropanesulfonic acid is C7H13NO4S.
What is the PubChem CID of 2-Acrylamido-2-methylpropanesulfonic acid?
The PubChem CID of 2-Acrylamido-2-methylpropanesulfonic acid is 65360.
What is the IUPAC name of 2-Acrylamido-2-methylpropanesulfonic acid?
The IUPAC name of 2-Acrylamido-2-methylpropanesulfonic acid is 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid.
What is the molecular weight of 2-Acrylamido-2-methylpropanesulfonic acid?
The molecular weight of 2-Acrylamido-2-methylpropanesulfonic acid is 207.25 g/mol.
What is the InChIKey of 2-Acrylamido-2-methylpropanesulfonic acid?
The InChIKey of 2-Acrylamido-2-methylpropanesulfonic acid is XHZPRMZZQOIPDS-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Acrylamido-2-methylpropanesulfonic acid?
The canonical SMILES of 2-Acrylamido-2-methylpropanesulfonic acid is CC(C)(CS(=O)(=O)O)NC(=O)C=C.
What is the CAS number of 2-Acrylamido-2-methylpropanesulfonic acid?
The CAS number of 2-Acrylamido-2-methylpropanesulfonic acid is 15214-89-8.
What is the UNII of 2-Acrylamido-2-methylpropanesulfonic acid?
The UNII of 2-Acrylamido-2-methylpropanesulfonic acid is 490HQE5KI5.
What is the ChEMBL ID of 2-Acrylamido-2-methylpropanesulfonic acid?
The ChEMBL ID of 2-Acrylamido-2-methylpropanesulfonic acid is CHEMBL1907040.
What is the topological polar surface area of 2-Acrylamido-2-methylpropanesulfonic acid?
The topological polar surface area of 2-Acrylamido-2-methylpropanesulfonic acid is 91.8Ų.